C19H17NO5S2 — CID 8648515
[2-(N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]anilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648515) has the molecular formula C19H17NO5S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-(N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]anilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-(N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]anilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648515 |
| Molecular Formula | C19H17NO5S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [2-(N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]anilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1cccs1)OCC(=O)N(c1ccccc1)[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C19H17NO5S2/c21-18(13-25-19(22)9-8-17-7-4-11-26-17)20(15-5-2-1-3-6-15)16-10-12-27(23,24)14-16/h1-12,16H,13-14H2/b9-8+/t16-/m1/s1 |
| InChIKey | AZCDXYZRXLYDJH-ROJDOSBLSA-N |
| XLogP | 2.65 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|