C17H18ClN3O4S2 — CID 86567234
2-[(4-chlorobenzoyl)amino]-5-piperidin-1-ylsulfonylthiophene-3-carboxamide (PubChem CID 86567234) has the molecular formula C17H18ClN3O4S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-5-piperidin-1-ylsulfonylthiophene-3-carboxamide.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-5-piperidin-1-ylsulfonylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 86567234 |
| Molecular Formula | C17H18ClN3O4S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-5-piperidin-1-ylsulfonylthiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)N2CCCCC2)sc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O4S2/c18-12-6-4-11(5-7-12)16(23)20-17-13(15(19)22)10-14(26-17)27(24,25)21-8-2-1-3-9-21/h4-7,10H,1-3,8-9H2,(H2,19,22)(H,20,23) |
| InChIKey | VQXJZNBXYMUOEN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |