C35H24FeN6O2S+ — CID 86573747
iron(3+);3-[(E)-[[(E)-(3-oxidonaphthalen-2-yl)methylideneamino]carbamothioylhydrazinylidene]methyl]naphthalen-2-olate;1,10-phenanthroline (PubChem CID 86573747) has the molecular formula C35H24FeN6O2S+ and a molecular weight of 648.53 g/mol. Its IUPAC name is iron(3+);3-[(E)-[[(E)-(3-oxidonaphthalen-2-yl)methylideneamino]carbamothioylhydrazinylidene]methyl]naphthalen-2-olate;1,10-phenanthroline.
| Compound Name | iron(3+);3-[(E)-[[(E)-(3-oxidonaphthalen-2-yl)methylideneamino]carbamothioylhydrazinylidene]methyl]naphthalen-2-olate;1,10-phenanthroline |
|---|---|
| PubChem CID | 86573747 |
| Molecular Formula | C35H24FeN6O2S+ |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | iron(3+);3-[(E)-[[(E)-(3-oxidonaphthalen-2-yl)methylideneamino]carbamothioylhydrazinylidene]methyl]naphthalen-2-olate;1,10-phenanthroline |
| SMILES | [Fe+3].[O-]c1cc2ccccc2cc1/C=N/NC(=S)N/N=C/c1cc2ccccc2cc1[O-].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C23H18N4O2S.C12H8N2.Fe/c28-21-11-17-7-3-1-5-15(17)9-19(21)13-24-26-23(30)27-25-14-20-10-16-6-2-4-8-18(16)12-22(20)29;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-14,28-29H,(H2,26,27,30);1-8H;/q;;+3/p-2/b24-13+,25-14+;; |
| InChIKey | HJJYDJGKPVINTH-XENBWOBTSA-L |
| XLogP | 5.75 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|