C21H17BrN2O5S — CID 86573937
(E)-N-[4-[(3-bromophenyl)sulfamoyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 86573937) has the molecular formula C21H17BrN2O5S and a molecular weight of 489.35 g/mol. Its IUPAC name is (E)-N-[4-[(3-bromophenyl)sulfamoyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(3-bromophenyl)sulfamoyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 86573937 |
| Molecular Formula | C21H17BrN2O5S |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | (E)-N-[4-[(3-bromophenyl)sulfamoyl]phenyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Nc1ccc(S(=O)(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H17BrN2O5S/c22-15-2-1-3-17(13-15)24-30(28,29)18-8-6-16(7-9-18)23-21(27)11-5-14-4-10-19(25)20(26)12-14/h1-13,24-26H,(H,23,27)/b11-5+ |
| InChIKey | LBIGBZDPTXPKAQ-VZUCSPMQSA-N |
| XLogP | 4.31 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|