C11H22O4S — CID 86574824
(3S,4S,5R)-2-hexylsulfanyl-5-methoxyoxolane-3,4-diol (PubChem CID 86574824) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is (3S,4S,5R)-2-hexylsulfanyl-5-methoxyoxolane-3,4-diol.
| Compound Name | (3S,4S,5R)-2-hexylsulfanyl-5-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 86574824 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3S,4S,5R)-2-hexylsulfanyl-5-methoxyoxolane-3,4-diol |
| SMILES | CCCCCCSC1O[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22O4S/c1-3-4-5-6-7-16-11-9(13)8(12)10(14-2)15-11/h8-13H,3-7H2,1-2H3/t8-,9-,10+,11?/m0/s1 |
| InChIKey | YTRWCEWQTMXEAO-GKDVJIACSA-N |
| XLogP | 1.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|