About 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol
6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol (PubChem CID 86576983) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol.
Molecular Properties
| Compound Name | 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol |
| PubChem CID | 86576983 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol |
| SMILES | CC(Nc1ccccc1)c1cc2c(cc1O)OC(C)(C)C=C2 |
| InChI | InChI=1S/C19H21NO2/c1-13(20-15-7-5-4-6-8-15)16-11-14-9-10-19(2,3)22-18(14)12-17(16)21/h4-13,20-21H,1-3H3 |
| InChIKey | ZQCXWAJTCXRZEO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol?
The IUPAC name of 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol (CID 86576983) is 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol.
What is the SMILES notation for 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol?
The canonical SMILES for 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol is CC(Nc1ccccc1)c1cc2c(cc1O)OC(C)(C)C=C2.
What is the InChIKey of 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol?
The InChIKey is ZQCXWAJTCXRZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO2/c1-13(20-15-7-5-4-6-8-15)16-11-14-9-10-19(2,3)22-18(14)12-17(16)21/h4-13,20-21H,1-3H3.
What are the key properties of 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol?
6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol has a molecular weight of 295.38 g/mol, XLogP of 4.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-anilinoethyl)-2,2-dimethylchromen-7-ol is sourced from PubChem (CID 86576983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).