C28H24N4O4S — CID 86578259
N-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxyphenyl]-2-methylbenzenesulfonamide (PubChem CID 86578259) has the molecular formula C28H24N4O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxyphenyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxyphenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86578259 |
| Molecular Formula | C28H24N4O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[5-(2-amino-4-oxo-3-phenylquinazolin-6-yl)-2-methoxyphenyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cc1NS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C28H24N4O4S/c1-18-8-6-7-11-26(18)37(34,35)31-24-17-20(13-15-25(24)36-2)19-12-14-23-22(16-19)27(33)32(28(29)30-23)21-9-4-3-5-10-21/h3-17,31H,1-2H3,(H2,29,30) |
| InChIKey | FEWRJSWEFZPMCE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |