C20H19N5O4 — CID 86578521
4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]quinazoline (PubChem CID 86578521) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]quinazoline.
| Compound Name | 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]quinazoline |
|---|---|
| PubChem CID | 86578521 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]quinazoline |
| SMILES | COc1cc(-c2n[nH]c(COc3ncnc4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N5O4/c1-26-15-8-12(9-16(27-2)18(15)28-3)19-23-17(24-25-19)10-29-20-13-6-4-5-7-14(13)21-11-22-20/h4-9,11H,10H2,1-3H3,(H,23,24,25) |
| InChIKey | WDSAZPAXBCXWMI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |