C25H26F2N5OS+ — CID 86580049
(2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580049) has the molecular formula C25H26F2N5OS+ and a molecular weight of 482.58 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580049 |
| Molecular Formula | C25H26F2N5OS+ |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-methylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | Cc1ccc(-c2nc3c(s2)CN([C@H](C)[C@](O)(C[n+]2cnc[nH]2)c2ccc(F)cc2F)CC3)cc1 |
| InChI | InChI=1S/C25H25F2N5OS/c1-16-3-5-18(6-4-16)24-30-22-9-10-31(12-23(22)34-24)17(2)25(33,13-32-15-28-14-29-32)20-8-7-19(26)11-21(20)27/h3-8,11,14-15,17,33H,9-10,12-13H2,1-2H3/p+1/t17-,25-/m1/s1 |
| InChIKey | GHAACXXRHNSMRT-CRICUBBOSA-O |
| XLogP | 3.74 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|