C28H32F2N5OS+ — CID 86580048
(2R,3R)-3-[2-(4-tert-butylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580048) has the molecular formula C28H32F2N5OS+ and a molecular weight of 524.66 g/mol. Its IUPAC name is (2R,3R)-3-[2-(4-tert-butylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-3-[2-(4-tert-butylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580048 |
| Molecular Formula | C28H32F2N5OS+ |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (2R,3R)-3-[2-(4-tert-butylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CCc2nc(-c3ccc(C(C)(C)C)cc3)sc2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H31F2N5OS/c1-18(28(36,15-35-17-31-16-32-35)22-10-9-21(29)13-23(22)30)34-12-11-24-25(14-34)37-26(33-24)19-5-7-20(8-6-19)27(2,3)4/h5-10,13,16-18,36H,11-12,14-15H2,1-4H3/p+1/t18-,28-/m1/s1 |
| InChIKey | CAZRYJQDNHHUBK-KWMCUTETSA-O |
| XLogP | 4.73 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|