C21H23F2N7O2+2 — CID 86579895
(2R,3R)-2-(2,4-difluorophenyl)-3-[2-(furan-2-yl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86579895) has the molecular formula C21H23F2N7O2+2 and a molecular weight of 443.46 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(furan-2-yl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(furan-2-yl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86579895 |
| Molecular Formula | C21H23F2N7O2+2 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(furan-2-yl)-3,5,6,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-7-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2[nH]c(-c3ccco3)nc2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F2N7O2/c1-14(28-6-7-30-19(10-28)26-20(27-30)18-3-2-8-32-18)21(31,11-29-13-24-12-25-29)16-5-4-15(22)9-17(16)23/h2-5,8-9,12-14,31H,6-7,10-11H2,1H3/p+2/t14-,21-/m1/s1 |
| InChIKey | KSEVMJFZPQZZRC-SPLOXXLWSA-P |
| XLogP | 1.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|