C23H22F3N6OS+ — CID 86580211
(2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-fluoro-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol (PubChem CID 86580211) has the molecular formula C23H22F3N6OS+ and a molecular weight of 487.53 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-fluoro-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-fluoro-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 86580211 |
| Molecular Formula | C23H22F3N6OS+ |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[2-(4-fluoro-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-1-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-ol |
| SMILES | C[C@@H](N1CCc2nc(-c3cnccc3F)sc2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H21F3N6OS/c1-14(23(33,11-32-13-28-12-29-32)17-3-2-15(24)8-19(17)26)31-7-5-20-21(10-31)34-22(30-20)16-9-27-6-4-18(16)25/h2-4,6,8-9,12-14,33H,5,7,10-11H2,1H3/p+1/t14-,23-/m1/s1 |
| InChIKey | JYKQHGCBSWUAHS-QKFKETGDSA-O |
| XLogP | 2.97 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|