C19H21F5N6O+2 — CID 86578863
(2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-(trifluoromethyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol (PubChem CID 86578863) has the molecular formula C19H21F5N6O+2 and a molecular weight of 444.41 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-(trifluoromethyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-(trifluoromethyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol |
|---|---|
| PubChem CID | 86578863 |
| Molecular Formula | C19H21F5N6O+2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-2-ium-2-yl)-3-[2-(trifluoromethyl)-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-yl]butan-2-ol |
| SMILES | C[C@@H](N1CC[n+]2cc(C(F)(F)F)[nH]c2C1)[C@](O)(C[n+]1cnc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F5N6O/c1-12(28-4-5-29-7-16(19(22,23)24)27-17(29)8-28)18(31,9-30-11-25-10-26-30)14-3-2-13(20)6-15(14)21/h2-3,6-7,10-12,31H,4-5,8-9H2,1H3/p+2/t12-,18-/m1/s1 |
| InChIKey | BKQMJAQDNXATDF-KZULUSFZSA-P |
| XLogP | 1.40 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|