C25H25N4O2P — CID 86580064
6-(3-aminophenyl)-N-[3-[[ethoxy(phenyl)phosphoryl]methyl]phenyl]pyrimidin-4-amine (PubChem CID 86580064) has the molecular formula C25H25N4O2P and a molecular weight of 444.48 g/mol. Its IUPAC name is 6-(3-aminophenyl)-N-[3-[[ethoxy(phenyl)phosphoryl]methyl]phenyl]pyrimidin-4-amine.
| Compound Name | 6-(3-aminophenyl)-N-[3-[[ethoxy(phenyl)phosphoryl]methyl]phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86580064 |
| Molecular Formula | C25H25N4O2P |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 6-(3-aminophenyl)-N-[3-[[ethoxy(phenyl)phosphoryl]methyl]phenyl]pyrimidin-4-amine |
| SMILES | CCOP(=O)(Cc1cccc(Nc2cc(-c3cccc(N)c3)ncn2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H25N4O2P/c1-2-31-32(30,23-12-4-3-5-13-23)17-19-8-6-11-22(14-19)29-25-16-24(27-18-28-25)20-9-7-10-21(26)15-20/h3-16,18H,2,17,26H2,1H3,(H,27,28,29) |
| InChIKey | HSGUPAGFYAWDAY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|