C19H19F3N4O3S — CID 86580701
2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 86580701) has the molecular formula C19H19F3N4O3S and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 86580701 |
| Molecular Formula | C19H19F3N4O3S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(=C(C#N)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N4O3S/c1-12-18(13(2)25-24-12)30(27,28)26-9-7-15(8-10-26)17(11-23)14-3-5-16(6-4-14)29-19(20,21)22/h3-6H,7-10H2,1-2H3,(H,24,25) |
| InChIKey | KRQZAVUNAGZXQM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|