C18H15F3N4O2 — CID 171473619
2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 171473619) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 171473619 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[1-(imidazole-1-carbonyl)piperidin-4-ylidene]-2-[4-(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | N#CC(=C1CCN(C(=O)n2ccnc2)CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N4O2/c19-18(20,21)27-15-3-1-13(2-4-15)16(11-22)14-5-8-24(9-6-14)17(26)25-10-7-23-12-25/h1-4,7,10,12H,5-6,8-9H2 |
| InChIKey | ORHQZNFYSXXUBG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|