C25H27N5O3 — CID 86580826
5-[[4-(3,5-dimethoxyphenyl)pyrimidin-2-yl]amino]-2-[4-(hydroxymethyl)piperidin-1-yl]benzonitrile (PubChem CID 86580826) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 5-[[4-(3,5-dimethoxyphenyl)pyrimidin-2-yl]amino]-2-[4-(hydroxymethyl)piperidin-1-yl]benzonitrile.
| Compound Name | 5-[[4-(3,5-dimethoxyphenyl)pyrimidin-2-yl]amino]-2-[4-(hydroxymethyl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 86580826 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 5-[[4-(3,5-dimethoxyphenyl)pyrimidin-2-yl]amino]-2-[4-(hydroxymethyl)piperidin-1-yl]benzonitrile |
| SMILES | COc1cc(OC)cc(-c2ccnc(Nc3ccc(N4CCC(CO)CC4)c(C#N)c3)n2)c1 |
| InChI | InChI=1S/C25H27N5O3/c1-32-21-12-18(13-22(14-21)33-2)23-5-8-27-25(29-23)28-20-3-4-24(19(11-20)15-26)30-9-6-17(16-31)7-10-30/h3-5,8,11-14,17,31H,6-7,9-10,16H2,1-2H3,(H,27,28,29) |
| InChIKey | DLNVSHSKZQFWAG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|