C27H23ClN2O6 — CID 86582533
methyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]-3-(1H-indol-3-yl)propanoate;hydrochloride (PubChem CID 86582533) has the molecular formula C27H23ClN2O6 and a molecular weight of 506.94 g/mol. Its IUPAC name is methyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]-3-(1H-indol-3-yl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]-3-(1H-indol-3-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 86582533 |
| Molecular Formula | C27H23ClN2O6 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | methyl (2S)-2-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]-3-(1H-indol-3-yl)propanoate;hydrochloride |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NCc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.Cl |
| InChI | InChI=1S/C27H22N2O6.ClH/c1-35-27(34)20(11-15-13-29-19-7-3-2-5-16(15)19)28-12-14-9-18-24(22(31)10-14)26(33)23-17(25(18)32)6-4-8-21(23)30;/h2-10,13,20,28-31H,11-12H2,1H3;1H/t20-;/m0./s1 |
| InChIKey | RCCNQLBYCOPNBT-BDQAORGHSA-N |
| XLogP | 3.65 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|