C31H30F6N2O2 — CID 86586745
(1R,2R,5S,6R)-8-benzyl-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 86586745) has the molecular formula C31H30F6N2O2 and a molecular weight of 576.58 g/mol. Its IUPAC name is (1R,2R,5S,6R)-8-benzyl-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | (1R,2R,5S,6R)-8-benzyl-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 86586745 |
| Molecular Formula | C31H30F6N2O2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | (1R,2R,5S,6R)-8-benzyl-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | C[C@H](O[C@@H]1CC[C@H]2[C@H](C(N)=O)C[C@]1(c1ccccc1)N2Cc1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H30F6N2O2/c1-19(21-14-23(30(32,33)34)16-24(15-21)31(35,36)37)41-27-13-12-26-25(28(38)40)17-29(27,22-10-6-3-7-11-22)39(26)18-20-8-4-2-5-9-20/h2-11,14-16,19,25-27H,12-13,17-18H2,1H3,(H2,38,40)/t19-,25+,26-,27+,29+/m0/s1 |
| InChIKey | YGKIEWGDVHDSLD-VVPYMHNBSA-N |
| XLogP | 7.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |