C30H27F6NO2 — CID 87950787
8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carbaldehyde (PubChem CID 87950787) has the molecular formula C30H27F6NO2 and a molecular weight of 547.54 g/mol. Its IUPAC name is 8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carbaldehyde.
| Compound Name | 8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carbaldehyde |
|---|---|
| PubChem CID | 87950787 |
| Molecular Formula | C30H27F6NO2 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octane-6-carbaldehyde |
| SMILES | O=CC1CC2(c3ccccc3)C(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC1N2Cc1ccccc1 |
| InChI | InChI=1S/C30H27F6NO2/c31-29(32,33)24-13-21(14-25(15-24)30(34,35)36)19-39-27-12-11-26-22(18-38)16-28(27,23-9-5-2-6-10-23)37(26)17-20-7-3-1-4-8-20/h1-10,13-15,18,22,26-27H,11-12,16-17,19H2 |
| InChIKey | HULWIGBUFHMFJX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|