C37H40F6N6O3 — CID 86586752
tert-butyl N-[2-[5-[(1R,2R,5S,6R)-8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octan-6-yl]tetrazol-2-yl]ethyl]carbamate (PubChem CID 86586752) has the molecular formula C37H40F6N6O3 and a molecular weight of 730.75 g/mol. Its IUPAC name is tert-butyl N-[2-[5-[(1R,2R,5S,6R)-8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octan-6-yl]tetrazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-[(1R,2R,5S,6R)-8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octan-6-yl]tetrazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 86586752 |
| Molecular Formula | C37H40F6N6O3 |
| Molecular Weight | 730.75 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | tert-butyl N-[2-[5-[(1R,2R,5S,6R)-8-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenyl-8-azabicyclo[3.2.1]octan-6-yl]tetrazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1nnc([C@@H]2C[C@@]3(c4ccccc4)[C@H](OCc4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC[C@@H]2N3Cc2ccccc2)n1 |
| InChI | InChI=1S/C37H40F6N6O3/c1-34(2,3)52-33(50)44-16-17-49-46-32(45-47-49)29-21-35(26-12-8-5-9-13-26)31(15-14-30(29)48(35)22-24-10-6-4-7-11-24)51-23-25-18-27(36(38,39)40)20-28(19-25)37(41,42)43/h4-13,18-20,29-31H,14-17,21-23H2,1-3H3,(H,44,50)/t29-,30+,31-,35-/m1/s1 |
| InChIKey | DBLLOLIPXZSDJO-UIUKDCGCSA-N |
| XLogP | 7.87 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |