C29H23F6NO3 — CID 58592529
2-[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylcyclopentyl]isoindole-1,3-dione (PubChem CID 58592529) has the molecular formula C29H23F6NO3 and a molecular weight of 547.50 g/mol. Its IUPAC name is 2-[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylcyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylcyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58592529 |
| Molecular Formula | C29H23F6NO3 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 2-[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylcyclopentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1CC[C@@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)C1 |
| InChI | InChI=1S/C29H23F6NO3/c30-28(31,32)20-12-18(13-21(14-20)29(33,34)35)16-39-17-27(19-6-2-1-3-7-19)11-10-22(15-27)36-25(37)23-8-4-5-9-24(23)26(36)38/h1-9,12-14,22H,10-11,15-17H2/t22-,27-/m1/s1 |
| InChIKey | LNFHDBOCOFJNBK-AJTFRIOCSA-N |
| XLogP | 7.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|