C37H53F5O4 — CID 86588527
ethyl 11-[(7R,8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)undec-9-enoate (PubChem CID 86588527) has the molecular formula C37H53F5O4 and a molecular weight of 656.82 g/mol. Its IUPAC name is ethyl 11-[(7R,8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)undec-9-enoate.
| Compound Name | ethyl 11-[(7R,8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)undec-9-enoate |
|---|---|
| PubChem CID | 86588527 |
| Molecular Formula | C37H53F5O4 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | ethyl 11-[(7R,8R,9S,13S,14S,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)undec-9-enoate |
| SMILES | CCOC(=O)C(CCCCCCC=CC[C@@H]1Cc2cc(OC)ccc2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@H]12)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C37H53F5O4/c1-4-46-34(44)25(15-12-21-36(38,39)37(40,41)42)13-10-8-6-5-7-9-11-14-26-23-27-24-28(45-3)16-17-29(27)30-20-22-35(2)31(33(26)30)18-19-32(35)43/h9,11,16-17,24-26,30-33,43H,4-8,10,12-15,18-23H2,1-3H3/t25?,26-,30-,31+,32+,33-,35+/m1/s1 |
| InChIKey | GQGYHXHWYMOJNZ-AWEOYUOFSA-N |
| XLogP | 9.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|