C35H51F5O — CID 91093856
(7R,13S,17S)-3,13-dimethyl-7-(14,14,15,15,15-pentafluoro-10-methylpentadec-2-enyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 91093856) has the molecular formula C35H51F5O and a molecular weight of 582.78 g/mol. Its IUPAC name is (7R,13S,17S)-3,13-dimethyl-7-(14,14,15,15,15-pentafluoro-10-methylpentadec-2-enyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (7R,13S,17S)-3,13-dimethyl-7-(14,14,15,15,15-pentafluoro-10-methylpentadec-2-enyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 91093856 |
| Molecular Formula | C35H51F5O |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | (7R,13S,17S)-3,13-dimethyl-7-(14,14,15,15,15-pentafluoro-10-methylpentadec-2-enyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1ccc2c(c1)CC(CC=CCCCCCCC(C)CCCC(F)(F)C(F)(F)F)C1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C35H51F5O/c1-24(13-11-20-34(36,37)35(38,39)40)12-9-7-5-4-6-8-10-14-26-23-27-22-25(2)15-16-28(27)29-19-21-33(3)30(32(26)29)17-18-31(33)41/h8,10,15-16,22,24,26,29-32,41H,4-7,9,11-14,17-21,23H2,1-3H3/t24?,26?,29?,30?,31-,32?,33-/m0/s1 |
| InChIKey | RDUNNUDTXDPZIJ-PDBFNKAESA-N |
| XLogP | 10.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|