C33H52O3 — CID 157341951
(2S)-11-[(13S,17S)-17-hydroxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-propylundecanoic acid (PubChem CID 157341951) has the molecular formula C33H52O3 and a molecular weight of 496.78 g/mol. Its IUPAC name is (2S)-11-[(13S,17S)-17-hydroxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-propylundecanoic acid.
| Compound Name | (2S)-11-[(13S,17S)-17-hydroxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-propylundecanoic acid |
|---|---|
| PubChem CID | 157341951 |
| Molecular Formula | C33H52O3 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | (2S)-11-[(13S,17S)-17-hydroxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-propylundecanoic acid |
| SMILES | CCC[C@@H](CCCCCCCCCC1Cc2cc(C)ccc2C2CC[C@@]3(C)C(CC[C@@H]3O)C12)C(=O)O |
| InChI | InChI=1S/C33H52O3/c1-4-12-24(32(35)36)13-10-8-6-5-7-9-11-14-25-22-26-21-23(2)15-16-27(26)28-19-20-33(3)29(31(25)28)17-18-30(33)34/h15-16,21,24-25,28-31,34H,4-14,17-20,22H2,1-3H3,(H,35,36)/t24-,25?,28?,29?,30-,31?,33-/m0/s1 |
| InChIKey | DGTUJKGUOSMHRJ-TXTHESOUSA-N |
| XLogP | 8.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|