C24H38O5Si — CID 86588778
tert-butyl 2-[[(2S,3R)-3-[(1Z,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetate (PubChem CID 86588778) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is tert-butyl 2-[[(2S,3R)-3-[(1Z,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[(2S,3R)-3-[(1Z,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 86588778 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | tert-butyl 2-[[(2S,3R)-3-[(1Z,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COC[C@@H]1OC2(CCCCC2)O[C@@H]1/C=C\C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C24H38O5Si/c1-23(2,3)29-22(25)19-26-18-21-20(14-10-7-8-13-17-30(4,5)6)27-24(28-21)15-11-9-12-16-24/h7-8,10,14,20-21H,9,11-12,15-16,18-19H2,1-6H3/b8-7+,14-10-/t20-,21+/m1/s1 |
| InChIKey | GBYFESIBMVQQQT-ISSGHXKXSA-N |
| XLogP | 4.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|