C21H34O5Si — CID 91263391
tert-butyl 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetate (PubChem CID 91263391) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is tert-butyl 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetate |
|---|---|
| PubChem CID | 91263391 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | tert-butyl 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COC[C@@H]1OC(C)(C)O[C@@H]1C=CC=CC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H34O5Si/c1-20(2,3)26-19(22)16-23-15-18-17(24-21(4,5)25-18)13-11-9-10-12-14-27(6,7)8/h9-11,13,17-18H,15-16H2,1-8H3/t17-,18+/m1/s1 |
| InChIKey | DIXUQLXZJGPPIO-MSOLQXFVSA-N |
| XLogP | 3.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|