C16H21N3S2 — CID 8659202
1-(2-methyl-1,3-benzothiazol-6-yl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8659202) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8659202 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(2-methyl-1,3-benzothiazol-6-yl)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | Cc1nc2ccc(NC(=S)N[C@@H]3CCCC[C@H]3C)cc2s1 |
| InChI | InChI=1S/C16H21N3S2/c1-10-5-3-4-6-13(10)19-16(20)18-12-7-8-14-15(9-12)21-11(2)17-14/h7-10,13H,3-6H2,1-2H3,(H2,18,19,20)/t10-,13-/m1/s1 |
| InChIKey | MBEVVVCZTGHLKU-ZWNOBZJWSA-N |
| XLogP | 4.47 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|