C27H27N4O7+ — CID 86593713
[9-[2-(acetyloxymethoxycarbonyl)-3-amino-4-nitrophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 86593713) has the molecular formula C27H27N4O7+ and a molecular weight of 519.53 g/mol. Its IUPAC name is [9-[2-(acetyloxymethoxycarbonyl)-3-amino-4-nitrophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-(acetyloxymethoxycarbonyl)-3-amino-4-nitrophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 86593713 |
| Molecular Formula | C27H27N4O7+ |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | [9-[2-(acetyloxymethoxycarbonyl)-3-amino-4-nitrophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CC(=O)OCOC(=O)c1c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C27H26N4O7/c1-15(32)36-14-37-27(33)25-20(10-11-21(26(25)28)31(34)35)24-18-8-6-16(29(2)3)12-22(18)38-23-13-17(30(4)5)7-9-19(23)24/h6-13H,14H2,1-5H3,(H-,28,33)/p+1 |
| InChIKey | GMCKMHGBZHSHOW-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|