C20H18FN3O2S2 — CID 8659545
1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(3-methylphenyl)thiourea (PubChem CID 8659545) has the molecular formula C20H18FN3O2S2 and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8659545 |
| Molecular Formula | C20H18FN3O2S2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCCN2C(=O)S/C(=C\c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C20H18FN3O2S2/c1-13-5-4-7-15(11-13)23-19(27)22-9-10-24-18(25)17(28-20(24)26)12-14-6-2-3-8-16(14)21/h2-8,11-12H,9-10H2,1H3,(H2,22,23,27)/b17-12- |
| InChIKey | MLVLAQXMWZXQJO-ATVHPVEESA-N |
| XLogP | 4.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|