About methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate
methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate (PubChem CID 86598636) has the molecular formula C14H8BrCl2FN4O2
and a molecular weight of 434.05 g/mol. Its IUPAC name is methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate |
| PubChem CID | 86598636 |
| Molecular Formula | C14H8BrCl2FN4O2 |
| Molecular Weight | 434.05 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate |
| SMILES | COC(=O)c1cc(Br)c(N=[N+]=[N-])c(F)c1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl2FN4O2/c1-24-14(23)7-5-8(15)13(21-22-19)11(18)12(7)20-10-3-2-6(16)4-9(10)17/h2-5,20H,1H3 |
| InChIKey | YXLUDPNLPXZGKX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.05 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate?
The IUPAC name of methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate (CID 86598636) is methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate.
What is the SMILES notation for methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate?
The canonical SMILES for methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate is COC(=O)c1cc(Br)c(N=[N+]=[N-])c(F)c1Nc1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate?
The InChIKey is YXLUDPNLPXZGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrCl2FN4O2/c1-24-14(23)7-5-8(15)13(21-22-19)11(18)12(7)20-10-3-2-6(16)4-9(10)17/h2-5,20H,1H3.
What are the key properties of methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate?
methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate has a molecular weight of 434.05 g/mol, XLogP of 6.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-azido-5-bromo-2-(2,4-dichloroanilino)-3-fluorobenzoate is sourced from PubChem (CID 86598636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).