C15H18F3NO4 — CID 86605148
ethyl (2R,3R)-3-amino-1,2,3,4-tetrahydronaphthalene-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 86605148) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is ethyl (2R,3R)-3-amino-1,2,3,4-tetrahydronaphthalene-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (2R,3R)-3-amino-1,2,3,4-tetrahydronaphthalene-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86605148 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl (2R,3R)-3-amino-1,2,3,4-tetrahydronaphthalene-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@@H]1Cc2ccccc2C[C@H]1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H17NO2.C2HF3O2/c1-2-16-13(15)11-7-9-5-3-4-6-10(9)8-12(11)14;3-2(4,5)1(6)7/h3-6,11-12H,2,7-8,14H2,1H3;(H,6,7)/t11-,12-;/m1./s1 |
| InChIKey | UHHGMFSYDUSIQF-MNMPKAIFSA-N |
| XLogP | 1.93 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |