C37H72N4O9 — CID 86606230
tert-butyl N-[2-[1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-8-hydroxyoctyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate (PubChem CID 86606230) has the molecular formula C37H72N4O9 and a molecular weight of 717.00 g/mol. Its IUPAC name is tert-butyl N-[2-[1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-8-hydroxyoctyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-8-hydroxyoctyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 86606230 |
| Molecular Formula | C37H72N4O9 |
| Molecular Weight | 717.00 g/mol |
| Exact Mass | 716.53 |
| IUPAC Name | tert-butyl N-[2-[1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-8-hydroxyoctyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(CCCCCCO)CN(CCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H72N4O9/c1-34(2,3)47-30(43)38-23-17-16-22-29(40-32(45)49-36(7,8)9)28(21-15-13-14-20-26-42)27-41(33(46)50-37(10,11)12)25-19-18-24-39-31(44)48-35(4,5)6/h28-29,42H,13-27H2,1-12H3,(H,38,43)(H,39,44)(H,40,45) |
| InChIKey | BNLGUDQFZRKUHS-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 164.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.00 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|