C28H23F17N4O3 — CID 86607052
2-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoic acid (PubChem CID 86607052) has the molecular formula C28H23F17N4O3 and a molecular weight of 786.48 g/mol. Its IUPAC name is 2-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoic acid.
| Compound Name | 2-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoic acid |
|---|---|
| PubChem CID | 86607052 |
| Molecular Formula | C28H23F17N4O3 |
| Molecular Weight | 786.48 g/mol |
| Exact Mass | 786.15 |
| IUPAC Name | 2-[[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]methyl]-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)NCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H23F17N4O3/c1-49(2)18-9-7-17(8-10-18)48-47-16-5-3-14(4-6-16)19(50)46-13-15(20(51)52)11-12-21(29,30)22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)45/h3-10,15H,11-13H2,1-2H3,(H,46,50)(H,51,52)/b48-47+ |
| InChIKey | LJQWQIAGDIRWIX-QJGAVIKSSA-N |
| XLogP | 9.39 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.48 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|