C15H20N4O2 — CID 86607498
cis-tert-butyl (1R,2S)-1-amino-2-(azidomethyl)-2-phenylcyclopropane-1-carboxylate (PubChem CID 86607498) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is cis-tert-butyl (1R,2S)-1-amino-2-(azidomethyl)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,2S)-1-amino-2-(azidomethyl)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86607498 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | cis-tert-butyl (1R,2S)-1-amino-2-(azidomethyl)-2-phenylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(N)C[C@@]1(CN=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C15H20N4O2/c1-13(2,3)21-12(20)15(16)9-14(15,10-18-19-17)11-7-5-4-6-8-11/h4-8H,9-10,16H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | GTVDMGKYQPBGKL-CABCVRRESA-N |
| XLogP | 2.68 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|