C17H24N4O3 — CID 102537795
tert-butyl 2-(2-azido-1-hydroxy-1-phenylethyl)pyrrolidine-1-carboxylate (PubChem CID 102537795) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 2-(2-azido-1-hydroxy-1-phenylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-azido-1-hydroxy-1-phenylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102537795 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | tert-butyl 2-(2-azido-1-hydroxy-1-phenylethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(O)(CN=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C17H24N4O3/c1-16(2,3)24-15(22)21-11-7-10-14(21)17(23,12-19-20-18)13-8-5-4-6-9-13/h4-6,8-9,14,23H,7,10-12H2,1-3H3 |
| InChIKey | ZFOYMOMZVZPVPX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|