C20H30BrNO5 — CID 162462589
tert-butyl (2S)-2-[(1R,3R)-1-(4-bromophenyl)-3-ethoxy-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate (PubChem CID 162462589) has the molecular formula C20H30BrNO5 and a molecular weight of 444.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R,3R)-1-(4-bromophenyl)-3-ethoxy-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R,3R)-1-(4-bromophenyl)-3-ethoxy-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162462589 |
| Molecular Formula | C20H30BrNO5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | tert-butyl (2S)-2-[(1R,3R)-1-(4-bromophenyl)-3-ethoxy-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate |
| SMILES | CCO[C@@H](O)C[C@@](O)(c1ccc(Br)cc1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30BrNO5/c1-5-26-17(23)13-20(25,14-8-10-15(21)11-9-14)16-7-6-12-22(16)18(24)27-19(2,3)4/h8-11,16-17,23,25H,5-7,12-13H2,1-4H3/t16-,17+,20+/m0/s1 |
| InChIKey | LWLSNHVKVUANCQ-SQGPQFPESA-N |
| XLogP | 3.78 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|