C24H35ClN2O5S — CID 86611839
tert-butyl N-[(3R)-1-[2-[(2-chlorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamate (PubChem CID 86611839) has the molecular formula C24H35ClN2O5S and a molecular weight of 499.07 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-[(2-chlorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-[(2-chlorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86611839 |
| Molecular Formula | C24H35ClN2O5S |
| Molecular Weight | 499.07 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-[(2-chlorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamate |
| SMILES | COC(OC)C(=O)C(Cc1ccccc1Cl)=C(SC)N1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H35ClN2O5S/c1-24(2,3)32-23(29)26-17-11-9-13-27(15-17)21(33-6)18(20(28)22(30-4)31-5)14-16-10-7-8-12-19(16)25/h7-8,10,12,17,22H,9,11,13-15H2,1-6H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | VXCNPXDKZICOCW-QGZVFWFLSA-N |
| XLogP | 4.63 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.07 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|