C20H26ClFN2O5S — CID 69437802
[(3R)-1-[2-[(2-chloro-5-fluorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamic acid (PubChem CID 69437802) has the molecular formula C20H26ClFN2O5S and a molecular weight of 460.96 g/mol. Its IUPAC name is [(3R)-1-[2-[(2-chloro-5-fluorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamic acid.
| Compound Name | [(3R)-1-[2-[(2-chloro-5-fluorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69437802 |
| Molecular Formula | C20H26ClFN2O5S |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [(3R)-1-[2-[(2-chloro-5-fluorophenyl)methyl]-4,4-dimethoxy-1-methylsulfanyl-3-oxobut-1-enyl]piperidin-3-yl]carbamic acid |
| SMILES | COC(OC)C(=O)C(Cc1cc(F)ccc1Cl)=C(SC)N1CCC[C@@H](NC(=O)O)C1 |
| InChI | InChI=1S/C20H26ClFN2O5S/c1-28-19(29-2)17(25)15(10-12-9-13(22)6-7-16(12)21)18(30-3)24-8-4-5-14(11-24)23-20(26)27/h6-7,9,14,19,23H,4-5,8,10-11H2,1-3H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | UDTMQUMOJPKETR-CQSZACIVSA-N |
| XLogP | 3.52 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|