C26H37F3O4SSi — CID 86615356
[4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl] trifluoromethanesulfonate (PubChem CID 86615356) has the molecular formula C26H37F3O4SSi and a molecular weight of 530.73 g/mol. Its IUPAC name is [4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86615356 |
| Molecular Formula | C26H37F3O4SSi |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl] trifluoromethanesulfonate |
| SMILES | CCC(CC)(c1ccc(O[Si](C)(C)C(C)(C)C)c(C)c1)c1ccc(OS(=O)(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C26H37F3O4SSi/c1-10-25(11-2,20-12-14-22(18(3)16-20)32-34(30,31)26(27,28)29)21-13-15-23(19(4)17-21)33-35(8,9)24(5,6)7/h12-17H,10-11H2,1-9H3 |
| InChIKey | QVYIISWXXNPLBD-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|