About piperidin-3-ylmethyl 4-methylbenzenesulfonate
piperidin-3-ylmethyl 4-methylbenzenesulfonate (PubChem CID 86616503) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is piperidin-3-ylmethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | piperidin-3-ylmethyl 4-methylbenzenesulfonate |
| PubChem CID | 86616503 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | piperidin-3-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCNC2)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-11-4-6-13(7-5-11)18(15,16)17-10-12-3-2-8-14-9-12/h4-7,12,14H,2-3,8-10H2,1H3 |
| InChIKey | RDLKBJKYDOPVDF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze piperidin-3-ylmethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-ylmethyl 4-methylbenzenesulfonate?
The IUPAC name of piperidin-3-ylmethyl 4-methylbenzenesulfonate (CID 86616503) is piperidin-3-ylmethyl 4-methylbenzenesulfonate.
What is the SMILES notation for piperidin-3-ylmethyl 4-methylbenzenesulfonate?
The canonical SMILES for piperidin-3-ylmethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CCCNC2)cc1.
What is the InChIKey of piperidin-3-ylmethyl 4-methylbenzenesulfonate?
The InChIKey is RDLKBJKYDOPVDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3S/c1-11-4-6-13(7-5-11)18(15,16)17-10-12-3-2-8-14-9-12/h4-7,12,14H,2-3,8-10H2,1H3.
What are the key properties of piperidin-3-ylmethyl 4-methylbenzenesulfonate?
piperidin-3-ylmethyl 4-methylbenzenesulfonate has a molecular weight of 269.37 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-ylmethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 86616503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).