C8H9ClF3NO4 — CID 86620467
(2S)-4-chloro-2-[ethyl-(2,2,2-trifluoroacetyl)amino]-4-oxobutanoic acid (PubChem CID 86620467) has the molecular formula C8H9ClF3NO4 and a molecular weight of 275.61 g/mol. Its IUPAC name is (2S)-4-chloro-2-[ethyl-(2,2,2-trifluoroacetyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-chloro-2-[ethyl-(2,2,2-trifluoroacetyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 86620467 |
| Molecular Formula | C8H9ClF3NO4 |
| Molecular Weight | 275.61 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (2S)-4-chloro-2-[ethyl-(2,2,2-trifluoroacetyl)amino]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)C(F)(F)F)[C@@H](CC(=O)Cl)C(=O)O |
| InChI | InChI=1S/C8H9ClF3NO4/c1-2-13(7(17)8(10,11)12)4(6(15)16)3-5(9)14/h4H,2-3H2,1H3,(H,15,16)/t4-/m0/s1 |
| InChIKey | MUMKCGUDHDTRBC-BYPYZUCNSA-N |
| XLogP | 1.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.61 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|