C11H11Cl2N5O3 — CID 86620621
5,6-dichloro-3-nitro-N-(3-propan-2-yloxy-1H-pyrazol-5-yl)pyridin-2-amine (PubChem CID 86620621) has the molecular formula C11H11Cl2N5O3 and a molecular weight of 332.15 g/mol. Its IUPAC name is 5,6-dichloro-3-nitro-N-(3-propan-2-yloxy-1H-pyrazol-5-yl)pyridin-2-amine.
| Compound Name | 5,6-dichloro-3-nitro-N-(3-propan-2-yloxy-1H-pyrazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 86620621 |
| Molecular Formula | C11H11Cl2N5O3 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 5,6-dichloro-3-nitro-N-(3-propan-2-yloxy-1H-pyrazol-5-yl)pyridin-2-amine |
| SMILES | CC(C)Oc1cc(Nc2nc(Cl)c(Cl)cc2[N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C11H11Cl2N5O3/c1-5(2)21-9-4-8(16-17-9)14-11-7(18(19)20)3-6(12)10(13)15-11/h3-5H,1-2H3,(H2,14,15,16,17) |
| InChIKey | LEPDHPPASAHAMW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|