C26H32F2N2O4 — CID 86622326
benzyl N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S,3R)-3-prop-2-enoxycyclopentyl]amino]butan-2-yl]carbamate (PubChem CID 86622326) has the molecular formula C26H32F2N2O4 and a molecular weight of 474.55 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S,3R)-3-prop-2-enoxycyclopentyl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S,3R)-3-prop-2-enoxycyclopentyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86622326 |
| Molecular Formula | C26H32F2N2O4 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | benzyl N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S,3R)-3-prop-2-enoxycyclopentyl]amino]butan-2-yl]carbamate |
| SMILES | C=CCO[C@@H]1CC[C@H](NC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C26H32F2N2O4/c1-2-10-33-23-9-8-22(15-23)29-16-25(31)24(13-19-11-20(27)14-21(28)12-19)30-26(32)34-17-18-6-4-3-5-7-18/h2-7,11-12,14,22-25,29,31H,1,8-10,13,15-17H2,(H,30,32)/t22-,23+,24-,25+/m0/s1 |
| InChIKey | NXMSHFYSBVTGOB-FQUZAXHOSA-N |
| XLogP | 3.88 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|