C31H34Cl2N2O5 — CID 86622362
benzyl N-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[[(1S,3R)-6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl]amino]butan-2-yl]carbamate (PubChem CID 86622362) has the molecular formula C31H34Cl2N2O5 and a molecular weight of 585.53 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[[(1S,3R)-6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[[(1S,3R)-6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86622362 |
| Molecular Formula | C31H34Cl2N2O5 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | benzyl N-[(2S,3R)-1-(3,5-dichlorophenyl)-3-hydroxy-4-[[(1S,3R)-6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl]amino]butan-2-yl]carbamate |
| SMILES | C=CCO[C@@H]1C[C@H](NC[C@@H](O)[C@H](Cc2cc(Cl)cc(Cl)c2)NC(=O)OCc2ccccc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C31H34Cl2N2O5/c1-3-11-39-30-17-27(26-16-24(38-2)9-10-25(26)30)34-18-29(36)28(14-21-12-22(32)15-23(33)13-21)35-31(37)40-19-20-7-5-4-6-8-20/h3-10,12-13,15-16,27-30,34,36H,1,11,14,17-19H2,2H3,(H,35,37)/t27-,28-,29+,30+/m0/s1 |
| InChIKey | RCBRPGIZRJISKJ-VZNYXHRGSA-N |
| XLogP | 6.18 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|