C23H30N2O2 — CID 89378500
(3S)-1-N-(6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine (PubChem CID 89378500) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (3S)-1-N-(6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine.
| Compound Name | (3S)-1-N-(6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 89378500 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (3S)-1-N-(6-methoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine |
| SMILES | C=CCOC1CC(NCC[C@@H](N)Cc2ccccc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C23H30N2O2/c1-3-13-27-23-16-22(21-15-19(26-2)9-10-20(21)23)25-12-11-18(24)14-17-7-5-4-6-8-17/h3-10,15,18,22-23,25H,1,11-14,16,24H2,2H3/t18-,22?,23?/m1/s1 |
| InChIKey | JEVVJHVARDDBAR-WDGBRCNXSA-N |
| XLogP | 3.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|