C24H25BF6N2O3 — CID 86623735
4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 86623735) has the molecular formula C24H25BF6N2O3 and a molecular weight of 514.28 g/mol. Its IUPAC name is 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 86623735 |
| Molecular Formula | C24H25BF6N2O3 |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(OCCN(CC(F)(F)F)c3ccc(C#N)c(C(F)(F)F)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H25BF6N2O3/c1-21(2)22(3,4)36-25(35-21)17-6-9-19(10-7-17)34-12-11-33(15-23(26,27)28)18-8-5-16(14-32)20(13-18)24(29,30)31/h5-10,13H,11-12,15H2,1-4H3 |
| InChIKey | PHWPFJBZOMZVIH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|