C15H26FNO2 — CID 86629086
tert-butyl N-[4-(4-fluorobutylidene)cyclohexyl]carbamate (PubChem CID 86629086) has the molecular formula C15H26FNO2 and a molecular weight of 271.38 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluorobutylidene)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluorobutylidene)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 86629086 |
| Molecular Formula | C15H26FNO2 |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl N-[4-(4-fluorobutylidene)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(=CCCCF)CC1 |
| InChI | InChI=1S/C15H26FNO2/c1-15(2,3)19-14(18)17-13-9-7-12(8-10-13)6-4-5-11-16/h6,13H,4-5,7-11H2,1-3H3,(H,17,18)/b12-6- |
| InChIKey | SFXHHQPXZSKQGN-SDQBBNPISA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|