C18H19Cl2N3O3S — CID 86632915
methyl 3-[(2,4-dichloro-6-methylphenyl)carbamothioylamino]-2-(2-hydroxyethylamino)benzoate (PubChem CID 86632915) has the molecular formula C18H19Cl2N3O3S and a molecular weight of 428.34 g/mol. Its IUPAC name is methyl 3-[(2,4-dichloro-6-methylphenyl)carbamothioylamino]-2-(2-hydroxyethylamino)benzoate.
| Compound Name | methyl 3-[(2,4-dichloro-6-methylphenyl)carbamothioylamino]-2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 86632915 |
| Molecular Formula | C18H19Cl2N3O3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | methyl 3-[(2,4-dichloro-6-methylphenyl)carbamothioylamino]-2-(2-hydroxyethylamino)benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)Nc2c(C)cc(Cl)cc2Cl)c1NCCO |
| InChI | InChI=1S/C18H19Cl2N3O3S/c1-10-8-11(19)9-13(20)15(10)23-18(27)22-14-5-3-4-12(17(25)26-2)16(14)21-6-7-24/h3-5,8-9,21,24H,6-7H2,1-2H3,(H2,22,23,27) |
| InChIKey | MGYHSQFXBUOCFM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|