C19H18Cl2F3N3O3S — CID 86632930
methyl 4-chloro-3-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]-2-(3-hydroxypropylamino)benzoate (PubChem CID 86632930) has the molecular formula C19H18Cl2F3N3O3S and a molecular weight of 496.34 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]-2-(3-hydroxypropylamino)benzoate.
| Compound Name | methyl 4-chloro-3-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]-2-(3-hydroxypropylamino)benzoate |
|---|---|
| PubChem CID | 86632930 |
| Molecular Formula | C19H18Cl2F3N3O3S |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | methyl 4-chloro-3-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]-2-(3-hydroxypropylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)Nc2ccc(Cl)cc2C(F)(F)F)c1NCCCO |
| InChI | InChI=1S/C19H18Cl2F3N3O3S/c1-30-17(29)11-4-5-13(21)16(15(11)25-7-2-8-28)27-18(31)26-14-6-3-10(20)9-12(14)19(22,23)24/h3-6,9,25,28H,2,7-8H2,1H3,(H2,26,27,31) |
| InChIKey | ISEXVTLMBTWWPV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|